C9H21N2O5S+ — CID 160570305
1-ethyl-2,3-dimethylimidazol-3-ium;ethyl hydrogen sulfate;hydrate (PubChem CID 160570305) has the molecular formula C9H21N2O5S+ and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazol-3-ium;ethyl hydrogen sulfate;hydrate.
| Compound Name | 1-ethyl-2,3-dimethylimidazol-3-ium;ethyl hydrogen sulfate;hydrate |
|---|---|
| PubChem CID | 160570305 |
| Molecular Formula | C9H21N2O5S+ |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazol-3-ium;ethyl hydrogen sulfate;hydrate |
| SMILES | CCOS(=O)(=O)O.CCn1cc[n+](C)c1C.O |
| InChI | InChI=1S/C7H13N2.C2H6O4S.H2O/c1-4-9-6-5-8(3)7(9)2;1-2-6-7(3,4)5;/h5-6H,4H2,1-3H3;2H2,1H3,(H,3,4,5);1H2/q+1;; |
| InChIKey | OCYLRKZSDKZSFQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|