C10H13BF7N3 — CID 89251299
cyano-difluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-ethyl-2,3-dimethylimidazol-3-ium (PubChem CID 89251299) has the molecular formula C10H13BF7N3 and a molecular weight of 319.03 g/mol. Its IUPAC name is cyano-difluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-ethyl-2,3-dimethylimidazol-3-ium.
| Compound Name | cyano-difluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-ethyl-2,3-dimethylimidazol-3-ium |
|---|---|
| PubChem CID | 89251299 |
| Molecular Formula | C10H13BF7N3 |
| Molecular Weight | 319.03 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | cyano-difluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-ethyl-2,3-dimethylimidazol-3-ium |
| SMILES | CCn1cc[n+](C)c1C.N#C[B-](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13N2.C3BF7N/c1-4-9-6-5-8(3)7(9)2;5-2(6,3(7,8)9)4(10,11)1-12/h5-6H,4H2,1-3H3;/q+1;-1 |
| InChIKey | QNPKTYKPDPTUJO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.03 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|