C9H14N3+ — CID 101343661
4-(2,3-dimethylimidazol-3-ium-1-yl)butanenitrile (PubChem CID 101343661) has the molecular formula C9H14N3+ and a molecular weight of 164.23 g/mol. Its IUPAC name is 4-(2,3-dimethylimidazol-3-ium-1-yl)butanenitrile.
| Compound Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butanenitrile |
|---|---|
| PubChem CID | 101343661 |
| Molecular Formula | C9H14N3+ |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butanenitrile |
| SMILES | Cc1n(CCCC#N)cc[n+]1C |
| InChI | InChI=1S/C9H14N3/c1-9-11(2)7-8-12(9)6-4-3-5-10/h7-8H,3-4,6H2,1-2H3/q+1 |
| InChIKey | OQGSNQXAYOKVHR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|