C11H22N3+ — CID 88593844
2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-diethylethanamine (PubChem CID 88593844) has the molecular formula C11H22N3+ and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-diethylethanamine.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 88593844 |
| Molecular Formula | C11H22N3+ |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1cc[n+](C)c1C |
| InChI | InChI=1S/C11H22N3/c1-5-13(6-2)8-10-14-9-7-12(4)11(14)3/h7,9H,5-6,8,10H2,1-4H3/q+1 |
| InChIKey | VFIYCXHWXZXPMA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|