C23H43N2+ — CID 102311499
1,2-dimethyl-3-[(Z)-octadec-9-enyl]imidazol-1-ium (PubChem CID 102311499) has the molecular formula C23H43N2+ and a molecular weight of 347.61 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(Z)-octadec-9-enyl]imidazol-1-ium.
| Compound Name | 1,2-dimethyl-3-[(Z)-octadec-9-enyl]imidazol-1-ium |
|---|---|
| PubChem CID | 102311499 |
| Molecular Formula | C23H43N2+ |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.34 |
| IUPAC Name | 1,2-dimethyl-3-[(Z)-octadec-9-enyl]imidazol-1-ium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCn1cc[n+](C)c1C |
| InChI | InChI=1S/C23H43N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-22-21-24(3)23(25)2/h11-12,21-22H,4-10,13-20H2,1-3H3/q+1/b12-11- |
| InChIKey | IUCKTIKYFFXZHF-QXMHVHEDSA-N |
| XLogP | 6.66 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|