C11H21B3F12N2-2 — CID 173080776
1-hexyl-2,3-dimethylimidazol-3-ium tritetrafluoroborate (PubChem CID 173080776) has the molecular formula C11H21B3F12N2-2 and a molecular weight of 441.72 g/mol. Its IUPAC name is 1-hexyl-2,3-dimethylimidazol-3-ium tritetrafluoroborate.
| Compound Name | 1-hexyl-2,3-dimethylimidazol-3-ium tritetrafluoroborate |
|---|---|
| PubChem CID | 173080776 |
| Molecular Formula | C11H21B3F12N2-2 |
| Molecular Weight | 441.72 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-hexyl-2,3-dimethylimidazol-3-ium tritetrafluoroborate |
| SMILES | CCCCCCn1cc[n+](C)c1C.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C11H21N2.3BF4/c1-4-5-6-7-8-13-10-9-12(3)11(13)2;3*2-1(3,4)5/h9-10H,4-8H2,1-3H3;;;/q+1;3*-1 |
| InChIKey | HXTNDHZWABYAJG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|