C8H10F6N3O4S2+ — CID 87267095
N-(1-ethyl-3-methylimidazol-3-ium-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 87267095) has the molecular formula C8H10F6N3O4S2+ and a molecular weight of 390.31 g/mol. Its IUPAC name is N-(1-ethyl-3-methylimidazol-3-ium-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | N-(1-ethyl-3-methylimidazol-3-ium-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 87267095 |
| Molecular Formula | C8H10F6N3O4S2+ |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | N-(1-ethyl-3-methylimidazol-3-ium-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCn1cc[n+](C)c1N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F6N3O4S2/c1-3-16-5-4-15(2)6(16)17(22(18,19)7(9,10)11)23(20,21)8(12,13)14/h4-5H,3H2,1-2H3/q+1 |
| InChIKey | IYQGAVJTANWIJP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|