C12H14F7N2O2+ — CID 90882736
(1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 90882736) has the molecular formula C12H14F7N2O2+ and a molecular weight of 351.24 g/mol. Its IUPAC name is (1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 90882736 |
| Molecular Formula | C12H14F7N2O2+ |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCCCn1cc[n+](C)c1OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F7N2O2/c1-3-4-5-21-7-6-20(2)9(21)23-8(22)10(13,14)11(15,16)12(17,18)19/h6-7H,3-5H2,1-2H3/q+1 |
| InChIKey | CXHJHQZAAWBGKC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|