C21H38N2O9S — CID 87076287
1-O-(1-ethoxyethyl) 3-O-methyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate (PubChem CID 87076287) has the molecular formula C21H38N2O9S and a molecular weight of 494.61 g/mol. Its IUPAC name is 1-O-(1-ethoxyethyl) 3-O-methyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate.
| Compound Name | 1-O-(1-ethoxyethyl) 3-O-methyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
|---|---|
| PubChem CID | 87076287 |
| Molecular Formula | C21H38N2O9S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-O-(1-ethoxyethyl) 3-O-methyl 2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCOC(C)OC(=O)C(C)(C(=O)OC)n1cc[n+](C)c1 |
| InChI | InChI=1S/C13H21N2O5.C8H18O4S/c1-6-19-10(2)20-12(17)13(3,11(16)18-5)15-8-7-14(4)9-15;1-2-3-4-5-6-7-8-12-13(9,10)11/h7-10H,6H2,1-5H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | WJEYJPXSDHETLK-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 137.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|