About 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide
1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide (PubChem CID 87076327) has the molecular formula C11H17BrN2O4
and a molecular weight of 321.17 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide |
| PubChem CID | 87076327 |
| Molecular Formula | C11H17BrN2O4 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide |
| SMILES | CCOC(=O)[C@@](C)(C(=O)OC)n1cc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C11H17N2O4.BrH/c1-5-17-10(15)11(2,9(14)16-4)13-7-6-12(3)8-13;/h6-8H,5H2,1-4H3;1H/q+1;/p-1/t11-;/m1./s1 |
| InChIKey | QCSNNAUSTZGGDF-RFVHGSKJSA-M |
| XLogP | -3.23 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide?
The IUPAC name of 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide (CID 87076327) is 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide.
What is the SMILES notation for 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide?
The canonical SMILES for 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide is CCOC(=O)[C@@](C)(C(=O)OC)n1cc[n+](C)c1.[Br-].
What is the InChIKey of 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide?
The InChIKey is QCSNNAUSTZGGDF-RFVHGSKJSA-M. The full InChI is InChI=1S/C11H17N2O4.BrH/c1-5-17-10(15)11(2,9(14)16-4)13-7-6-12(3)8-13;/h6-8H,5H2,1-4H3;1H/q+1;/p-1/t11-;/m1./s1.
What are the key properties of 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide?
1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide has a molecular weight of 321.17 g/mol, XLogP of -3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-methyl (2R)-2-methyl-2-(3-methylimidazol-3-ium-1-yl)propanedioate bromide is sourced from PubChem (CID 87076327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).