C10H16N2O4P+ — CID 90887667
ethyl 2-[2-(3-methylimidazol-3-ium-1-yl)acetyl]oxy-2-phosphanylacetate (PubChem CID 90887667) has the molecular formula C10H16N2O4P+ and a molecular weight of 259.22 g/mol. Its IUPAC name is ethyl 2-[2-(3-methylimidazol-3-ium-1-yl)acetyl]oxy-2-phosphanylacetate.
| Compound Name | ethyl 2-[2-(3-methylimidazol-3-ium-1-yl)acetyl]oxy-2-phosphanylacetate |
|---|---|
| PubChem CID | 90887667 |
| Molecular Formula | C10H16N2O4P+ |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | ethyl 2-[2-(3-methylimidazol-3-ium-1-yl)acetyl]oxy-2-phosphanylacetate |
| SMILES | CCOC(=O)C(P)OC(=O)Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C10H16N2O4P/c1-3-15-9(14)10(17)16-8(13)6-12-5-4-11(2)7-12/h4-5,7,10H,3,6,17H2,1-2H3/q+1 |
| InChIKey | OSKRWJCUUUGSLC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|