C8H14N3O+ — CID 101430503
N-ethyl-2-(3-methylimidazol-3-ium-1-yl)acetamide (PubChem CID 101430503) has the molecular formula C8H14N3O+ and a molecular weight of 168.22 g/mol. Its IUPAC name is N-ethyl-2-(3-methylimidazol-3-ium-1-yl)acetamide.
| Compound Name | N-ethyl-2-(3-methylimidazol-3-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 101430503 |
| Molecular Formula | C8H14N3O+ |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | N-ethyl-2-(3-methylimidazol-3-ium-1-yl)acetamide |
| SMILES | CCNC(=O)Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C8H13N3O/c1-3-9-8(12)6-11-5-4-10(2)7-11/h4-5,7H,3,6H2,1-2H3/p+1 |
| InChIKey | MPSBIWLBAYZFLE-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|