C9H16N3O5P — CID 58868462
methyl 2-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]ethyl phosphate (PubChem CID 58868462) has the molecular formula C9H16N3O5P and a molecular weight of 277.22 g/mol. Its IUPAC name is methyl 2-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]ethyl phosphate.
| Compound Name | methyl 2-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]ethyl phosphate |
|---|---|
| PubChem CID | 58868462 |
| Molecular Formula | C9H16N3O5P |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | methyl 2-[[2-(3-methylimidazol-3-ium-1-yl)acetyl]amino]ethyl phosphate |
| SMILES | COP(=O)([O-])OCCNC(=O)Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C9H16N3O5P/c1-11-4-5-12(8-11)7-9(13)10-3-6-17-18(14,15)16-2/h4-5,8H,3,6-7H2,1-2H3,(H-,10,13,14,15) |
| InChIKey | YLQWPOJMPNNZIH-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|