About 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide
1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide (PubChem CID 87367611) has the molecular formula C11H19BrN2O4
and a molecular weight of 323.19 g/mol. Its IUPAC name is 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide.
Molecular Properties
| Compound Name | 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide |
| PubChem CID | 87367611 |
| Molecular Formula | C11H19BrN2O4 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide |
| SMILES | COC(C)OC(C)OC(=O)Cn1cc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C11H19N2O4.BrH/c1-9(15-4)16-10(2)17-11(14)7-13-6-5-12(3)8-13;/h5-6,8-10H,7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SFNQFILPXHGFRD-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 53.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
The IUPAC name of 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide (CID 87367611) is 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide.
What is the SMILES notation for 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
The canonical SMILES for 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide is COC(C)OC(C)OC(=O)Cn1cc[n+](C)c1.[Br-].
What is the InChIKey of 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
The InChIKey is SFNQFILPXHGFRD-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H19N2O4.BrH/c1-9(15-4)16-10(2)17-11(14)7-13-6-5-12(3)8-13;/h5-6,8-10H,7H2,1-4H3;1H/q+1;/p-1.
What are the key properties of 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide?
1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide has a molecular weight of 323.19 g/mol, XLogP of -2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxyethoxy)ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate bromide is sourced from PubChem (CID 87367611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).