C26H47N2O2+ — CID 172651884
[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-(3-methylimidazol-3-ium-1-yl)acetate (PubChem CID 172651884) has the molecular formula C26H47N2O2+ and a molecular weight of 419.67 g/mol. Its IUPAC name is [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-(3-methylimidazol-3-ium-1-yl)acetate.
| Compound Name | [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-(3-methylimidazol-3-ium-1-yl)acetate |
|---|---|
| PubChem CID | 172651884 |
| Molecular Formula | C26H47N2O2+ |
| Molecular Weight | 419.67 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-(3-methylimidazol-3-ium-1-yl)acetate |
| SMILES | C/C(=C\COC(=O)Cn1cc[n+](C)c1)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C26H47N2O2/c1-22(2)10-7-11-23(3)12-8-13-24(4)14-9-15-25(5)16-19-30-26(29)20-28-18-17-27(6)21-28/h16-18,21-24H,7-15,19-20H2,1-6H3/q+1/b25-16+/t23-,24-/m1/s1 |
| InChIKey | RQSNVGXYSWKTIZ-DBCJPCAGSA-N |
| XLogP | 6.24 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|