C20H38N2O6S — CID 158822834
[(2R)-hexan-2-yl] 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate (PubChem CID 158822834) has the molecular formula C20H38N2O6S and a molecular weight of 434.60 g/mol. Its IUPAC name is [(2R)-hexan-2-yl] 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate.
| Compound Name | [(2R)-hexan-2-yl] 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate |
|---|---|
| PubChem CID | 158822834 |
| Molecular Formula | C20H38N2O6S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | [(2R)-hexan-2-yl] 2-(3-methylimidazol-3-ium-1-yl)acetate;octyl sulfate |
| SMILES | CCCCCCCCOS(=O)(=O)[O-].CCCC[C@@H](C)OC(=O)Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C12H21N2O2.C8H18O4S/c1-4-5-6-11(2)16-12(15)9-14-8-7-13(3)10-14;1-2-3-4-5-6-7-8-12-13(9,10)11/h7-8,10-11H,4-6,9H2,1-3H3;2-8H2,1H3,(H,9,10,11)/q+1;/p-1/t11-;/m1./s1 |
| InChIKey | IWBVLFOACXBSDA-RFVHGSKJSA-M |
| XLogP | 3.26 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|