C14H26N2O5 — CID 118645403
3-(2-ethoxyethoxy)propanoate;1-(2-methoxyethyl)-3-methylimidazol-3-ium (PubChem CID 118645403) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)propanoate;1-(2-methoxyethyl)-3-methylimidazol-3-ium.
| Compound Name | 3-(2-ethoxyethoxy)propanoate;1-(2-methoxyethyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 118645403 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 3-(2-ethoxyethoxy)propanoate;1-(2-methoxyethyl)-3-methylimidazol-3-ium |
| SMILES | CCOCCOCCC(=O)[O-].COCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C7H13N2O.C7H14O4/c1-8-3-4-9(7-8)5-6-10-2;1-2-10-5-6-11-4-3-7(8)9/h3-4,7H,5-6H2,1-2H3;2-6H2,1H3,(H,8,9)/q+1;/p-1 |
| InChIKey | KCXZECGFWCLRDG-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|