C11H18N2O6 — CID 175511800
1-methyl-3-propylimidazol-1-ium;oxalic acid;acetate (PubChem CID 175511800) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-methyl-3-propylimidazol-1-ium;oxalic acid;acetate.
| Compound Name | 1-methyl-3-propylimidazol-1-ium;oxalic acid;acetate |
|---|---|
| PubChem CID | 175511800 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-methyl-3-propylimidazol-1-ium;oxalic acid;acetate |
| SMILES | CC(=O)[O-].CCCn1cc[n+](C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H13N2.C2H2O4.C2H4O2/c1-3-4-9-6-5-8(2)7-9;3-1(4)2(5)6;1-2(3)4/h5-7H,3-4H2,1-2H3;(H,3,4)(H,5,6);1H3,(H,3,4)/q+1;;/p-1 |
| InChIKey | POUKMYAQQXMDTA-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|