C11H18N2O4 — CID 162308284
1,3-dipropylimidazol-1-ium;2-hydroxy-2-oxoacetate (PubChem CID 162308284) has the molecular formula C11H18N2O4 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,3-dipropylimidazol-1-ium;2-hydroxy-2-oxoacetate.
| Compound Name | 1,3-dipropylimidazol-1-ium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 162308284 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1,3-dipropylimidazol-1-ium;2-hydroxy-2-oxoacetate |
| SMILES | CCCn1cc[n+](CCC)c1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C9H17N2.C2H2O4/c1-3-5-10-7-8-11(9-10)6-4-2;3-1(4)2(5)6/h7-9H,3-6H2,1-2H3;(H,3,4)(H,5,6)/q+1;/p-1 |
| InChIKey | TVVHRWDOUZMJIZ-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|