C11H13I2NO4 — CID 13306747
2-ethoxyethyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate (PubChem CID 13306747) has the molecular formula C11H13I2NO4 and a molecular weight of 477.04 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate.
| Compound Name | 2-ethoxyethyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 13306747 |
| Molecular Formula | C11H13I2NO4 |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 476.89 |
| IUPAC Name | 2-ethoxyethyl 2-(3,5-diiodo-4-oxo-1-pyridinyl)acetate |
| SMILES | CCOCCOC(=O)Cn1cc(I)c(=O)c(I)c1 |
| InChI | InChI=1S/C11H13I2NO4/c1-2-17-3-4-18-10(15)7-14-5-8(12)11(16)9(13)6-14/h5-6H,2-4,7H2,1H3 |
| InChIKey | HHCQMGOYGHQYNN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|