C13H16N2O5 — CID 82345282
2-ethoxyethyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 82345282) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | 2-ethoxyethyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 82345282 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-ethoxyethyl 2-(4-amino-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | CCOCCOC(=O)Cn1c(=O)oc2cccc(N)c21 |
| InChI | InChI=1S/C13H16N2O5/c1-2-18-6-7-19-11(16)8-15-12-9(14)4-3-5-10(12)20-13(15)17/h3-5H,2,6-8,14H2,1H3 |
| InChIKey | XRSOPEHMVYKHPO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|