C10H12N2O3 — CID 82345373
4-amino-3-(3-hydroxypropyl)-1,3-benzoxazol-2-one (PubChem CID 82345373) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-amino-3-(3-hydroxypropyl)-1,3-benzoxazol-2-one.
| Compound Name | 4-amino-3-(3-hydroxypropyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82345373 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-amino-3-(3-hydroxypropyl)-1,3-benzoxazol-2-one |
| SMILES | Nc1cccc2oc(=O)n(CCCO)c12 |
| InChI | InChI=1S/C10H12N2O3/c11-7-3-1-4-8-9(7)12(5-2-6-13)10(14)15-8/h1,3-4,13H,2,5-6,11H2 |
| InChIKey | BHTHEXFSRKTPML-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|