C12H15NO3S — CID 66114976
3-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzoxazol-2-one (PubChem CID 66114976) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 66114976 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-[2-(3-hydroxypropylsulfanyl)ethyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCSCCCO |
| InChI | InChI=1S/C12H15NO3S/c14-7-3-8-17-9-6-13-10-4-1-2-5-11(10)16-12(13)15/h1-2,4-5,14H,3,6-9H2 |
| InChIKey | ATQWWVWORGBEEA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|