C18H17ClN2O6S — CID 53051968
propyl 2-[6-[(3-chlorophenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate (PubChem CID 53051968) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is propyl 2-[6-[(3-chlorophenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate.
| Compound Name | propyl 2-[6-[(3-chlorophenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate |
|---|---|
| PubChem CID | 53051968 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | propyl 2-[6-[(3-chlorophenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate |
| SMILES | CCCOC(=O)Cn1c(=O)oc2cc(S(=O)(=O)Nc3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C18H17ClN2O6S/c1-2-8-26-17(22)11-21-15-7-6-14(10-16(15)27-18(21)23)28(24,25)20-13-5-3-4-12(19)9-13/h3-7,9-10,20H,2,8,11H2,1H3 |
| InChIKey | XOPNLXHRTRRSCC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |