C20H22N2O7S — CID 53051993
propyl 2-[6-[(4-ethoxyphenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate (PubChem CID 53051993) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is propyl 2-[6-[(4-ethoxyphenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate.
| Compound Name | propyl 2-[6-[(4-ethoxyphenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate |
|---|---|
| PubChem CID | 53051993 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | propyl 2-[6-[(4-ethoxyphenyl)sulfamoyl]-2-oxo-1,3-benzoxazol-3-yl]acetate |
| SMILES | CCCOC(=O)Cn1c(=O)oc2cc(S(=O)(=O)Nc3ccc(OCC)cc3)ccc21 |
| InChI | InChI=1S/C20H22N2O7S/c1-3-11-28-19(23)13-22-17-10-9-16(12-18(17)29-20(22)24)30(25,26)21-14-5-7-15(8-6-14)27-4-2/h5-10,12,21H,3-4,11,13H2,1-2H3 |
| InChIKey | MZTFJNCWFPYKPC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |