C16H15ClN2O4S — CID 46346447
3-chloro-N-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)benzenesulfonamide (PubChem CID 46346447) has the molecular formula C16H15ClN2O4S and a molecular weight of 366.83 g/mol. Its IUPAC name is 3-chloro-N-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 46346447 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 3-chloro-N-(2-oxo-3-propyl-1,3-benzoxazol-6-yl)benzenesulfonamide |
| SMILES | CCCn1c(=O)oc2cc(NS(=O)(=O)c3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C16H15ClN2O4S/c1-2-8-19-14-7-6-12(10-15(14)23-16(19)20)18-24(21,22)13-5-3-4-11(17)9-13/h3-7,9-10,18H,2,8H2,1H3 |
| InChIKey | KXWBNVJWUHBAEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |