C30H40NO3+ — CID 87495975
(3-benzyl-3-methyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-(3-cyclohexyl-2-hydroxyphenyl)acetate (PubChem CID 87495975) has the molecular formula C30H40NO3+ and a molecular weight of 462.65 g/mol. Its IUPAC name is (3-benzyl-3-methyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-(3-cyclohexyl-2-hydroxyphenyl)acetate.
| Compound Name | (3-benzyl-3-methyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-(3-cyclohexyl-2-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 87495975 |
| Molecular Formula | C30H40NO3+ |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (3-benzyl-3-methyl-3-azoniabicyclo[3.2.1]octan-8-yl)methyl 2-(3-cyclohexyl-2-hydroxyphenyl)acetate |
| SMILES | C[N+]1(Cc2ccccc2)CC2CCC(C1)C2COC(=O)Cc1cccc(C2CCCCC2)c1O |
| InChI | InChI=1S/C30H39NO3/c1-31(18-22-9-4-2-5-10-22)19-25-15-16-26(20-31)28(25)21-34-29(32)17-24-13-8-14-27(30(24)33)23-11-6-3-7-12-23/h2,4-5,8-10,13-14,23,25-26,28H,3,6-7,11-12,15-21H2,1H3/p+1 |
| InChIKey | VBPLOPAHQIAQEG-UHFFFAOYSA-O |
| XLogP | 5.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|