C25H32NO3S+ — CID 25031472
(3-benzyl-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 25031472) has the molecular formula C25H32NO3S+ and a molecular weight of 426.60 g/mol. Its IUPAC name is (3-benzyl-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | (3-benzyl-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 25031472 |
| Molecular Formula | C25H32NO3S+ |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (3-benzyl-3-methyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | C[N+]1(Cc2ccccc2)CC2C(COC(=O)C(O)(c3cccs3)C3CCCC3)C2C1 |
| InChI | InChI=1S/C25H32NO3S/c1-26(14-18-8-3-2-4-9-18)15-20-21(16-26)22(20)17-29-24(27)25(28,19-10-5-6-11-19)23-12-7-13-30-23/h2-4,7-9,12-13,19-22,28H,5-6,10-11,14-17H2,1H3/q+1 |
| InChIKey | NRKXWNVZIZVHFT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|