C30H39N2O3+ — CID 87472160
2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl 2-(3-cycloheptyl-2-hydroxyphenyl)acetate (PubChem CID 87472160) has the molecular formula C30H39N2O3+ and a molecular weight of 475.65 g/mol. Its IUPAC name is 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl 2-(3-cycloheptyl-2-hydroxyphenyl)acetate.
| Compound Name | 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl 2-(3-cycloheptyl-2-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 87472160 |
| Molecular Formula | C30H39N2O3+ |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl 2-(3-cycloheptyl-2-hydroxyphenyl)acetate |
| SMILES | CC(C)c1n(CCOC(=O)Cc2cccc(C3CCCCCC3)c2O)cc[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C30H38N2O3/c1-23(2)30-31(17-18-32(30)22-24-11-6-5-7-12-24)19-20-35-28(33)21-26-15-10-16-27(29(26)34)25-13-8-3-4-9-14-25/h5-7,10-12,15-18,23,25H,3-4,8-9,13-14,19-22H2,1-2H3/p+1 |
| InChIKey | OIJDWUBPQOWASX-UHFFFAOYSA-O |
| XLogP | 5.88 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|