C22H29F2IN2O3 — CID 24753642
2-(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate iodide (PubChem CID 24753642) has the molecular formula C22H29F2IN2O3 and a molecular weight of 534.39 g/mol. Its IUPAC name is 2-(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate iodide.
| Compound Name | 2-(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate iodide |
|---|---|
| PubChem CID | 24753642 |
| Molecular Formula | C22H29F2IN2O3 |
| Molecular Weight | 534.39 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 2-(3-methyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate iodide |
| SMILES | CC(C)c1n(CCOC(=O)[C@](O)(c2ccccc2)[C@H]2CCC(F)(F)C2)cc[n+]1C.[I-] |
| InChI | InChI=1S/C22H29F2N2O3.HI/c1-16(2)19-25(3)11-12-26(19)13-14-29-20(27)22(28,17-7-5-4-6-8-17)18-9-10-21(23,24)15-18;/h4-8,11-12,16,18,28H,9-10,13-15H2,1-3H3;1H/q+1;/p-1/t18-,22-;/m0./s1 |
| InChIKey | PEYZEFSVCIURLY-COBSGTNCSA-M |
| XLogP | 0.31 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|