C20H25F2N2O3+ — CID 24753730
2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 24753730) has the molecular formula C20H25F2N2O3+ and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 24753730 |
| Molecular Formula | C20H25F2N2O3+ |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | Cc1n(CCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCC(F)(F)C2)cc[n+]1C |
| InChI | InChI=1S/C20H25F2N2O3/c1-15-23(2)10-11-24(15)12-13-27-18(25)20(26,16-6-4-3-5-7-16)17-8-9-19(21,22)14-17/h3-7,10-11,17,26H,8-9,12-14H2,1-2H3/q+1/t17-,20+/m1/s1 |
| InChIKey | FVEMSLCKVFBYPQ-XLIONFOSSA-N |
| XLogP | 2.49 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|