C23H31F2N2O3+ — CID 57463267
4-(2,3-dimethylimidazol-3-ium-1-yl)butyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate (PubChem CID 57463267) has the molecular formula C23H31F2N2O3+ and a molecular weight of 421.51 g/mol. Its IUPAC name is 4-(2,3-dimethylimidazol-3-ium-1-yl)butyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 57463267 |
| Molecular Formula | C23H31F2N2O3+ |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate |
| SMILES | Cc1n(CCCCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCCC(F)(F)C2)cc[n+]1C |
| InChI | InChI=1S/C23H31F2N2O3/c1-18-26(2)14-15-27(18)13-6-7-16-30-21(28)23(29,19-9-4-3-5-10-19)20-11-8-12-22(24,25)17-20/h3-5,9-10,14-15,20,29H,6-8,11-13,16-17H2,1-2H3/q+1/t20-,23+/m1/s1 |
| InChIKey | OINYDCXIUFRNHG-OFNKIYASSA-N |
| XLogP | 3.66 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|