C28H32Br2F2N2O3 — CID 25004316
3-[3-[(4-bromophenyl)methyl]-2-methylimidazol-3-ium-1-yl]propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide (PubChem CID 25004316) has the molecular formula C28H32Br2F2N2O3 and a molecular weight of 642.38 g/mol. Its IUPAC name is 3-[3-[(4-bromophenyl)methyl]-2-methylimidazol-3-ium-1-yl]propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide.
| Compound Name | 3-[3-[(4-bromophenyl)methyl]-2-methylimidazol-3-ium-1-yl]propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 25004316 |
| Molecular Formula | C28H32Br2F2N2O3 |
| Molecular Weight | 642.38 g/mol |
| Exact Mass | 640.07 |
| IUPAC Name | 3-[3-[(4-bromophenyl)methyl]-2-methylimidazol-3-ium-1-yl]propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
| SMILES | Cc1n(CCCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCCC(F)(F)C2)cc[n+]1Cc1ccc(Br)cc1.[Br-] |
| InChI | InChI=1S/C28H32BrF2N2O3.BrH/c1-21-32(16-17-33(21)20-22-10-12-25(29)13-11-22)15-6-18-36-26(34)28(35,23-7-3-2-4-8-23)24-9-5-14-27(30,31)19-24;/h2-4,7-8,10-13,16-17,24,35H,5-6,9,14-15,18-20H2,1H3;1H/q+1;/p-1/t24-,28+;/m1./s1 |
| InChIKey | MUTIDQULTAZUEE-CCUCXNRWSA-M |
| XLogP | 2.55 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|