C24H33BrF2N2O3 — CID 25003985
2-(2-methyl-3-pentylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate bromide (PubChem CID 25003985) has the molecular formula C24H33BrF2N2O3 and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-(2-methyl-3-pentylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate bromide.
| Compound Name | 2-(2-methyl-3-pentylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 25003985 |
| Molecular Formula | C24H33BrF2N2O3 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-(2-methyl-3-pentylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate bromide |
| SMILES | CCCCC[n+]1ccn(CCOC(=O)[C@](O)(c2ccccc2)[C@H]2CCC(F)(F)C2)c1C.[Br-] |
| InChI | InChI=1S/C24H33F2N2O3.BrH/c1-3-4-8-13-27-14-15-28(19(27)2)16-17-31-22(29)24(30,20-9-6-5-7-10-20)21-11-12-23(25,26)18-21;/h5-7,9-10,14-15,21,30H,3-4,8,11-13,16-18H2,1-2H3;1H/q+1;/p-1/t21-,24-;/m0./s1 |
| InChIKey | ZNFDOSNVFSGFFS-TUYUPMGOSA-M |
| XLogP | 1.14 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|