C28H33F2N2O3+ — CID 24753540
2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 24753540) has the molecular formula C28H33F2N2O3+ and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 24753540 |
| Molecular Formula | C28H33F2N2O3+ |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2-(3-benzyl-2-propan-2-ylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | CC(C)c1n(CCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCC(F)(F)C2)cc[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C28H33F2N2O3/c1-21(2)25-31(15-16-32(25)20-22-9-5-3-6-10-22)17-18-35-26(33)28(34,23-11-7-4-8-12-23)24-13-14-27(29,30)19-24/h3-12,15-16,21,24,34H,13-14,17-20H2,1-2H3/q+1/t24-,28+/m1/s1 |
| InChIKey | SCHWCGSDSHMGSF-YWEHKCAJSA-N |
| XLogP | 4.81 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|