C23H31BrF2N2O3 — CID 57463331
2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide (PubChem CID 57463331) has the molecular formula C23H31BrF2N2O3 and a molecular weight of 501.41 g/mol. Its IUPAC name is 2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide.
| Compound Name | 2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 57463331 |
| Molecular Formula | C23H31BrF2N2O3 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-(2-methyl-3-propylimidazol-3-ium-1-yl)ethyl (2R)-2-[(1S)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
| SMILES | CCC[n+]1ccn(CCOC(=O)[C@](O)(c2ccccc2)[C@H]2CCCC(F)(F)C2)c1C.[Br-] |
| InChI | InChI=1S/C23H31F2N2O3.BrH/c1-3-12-26-13-14-27(18(26)2)15-16-30-21(28)23(29,19-8-5-4-6-9-19)20-10-7-11-22(24,25)17-20;/h4-6,8-9,13-14,20,29H,3,7,10-12,15-17H2,1-2H3;1H/q+1;/p-1/t20-,23-;/m0./s1 |
| InChIKey | PNDOEZXUSFYYQP-WCRWPNQISA-M |
| XLogP | 0.75 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|