C21H27F2N2O3+ — CID 57463237
3-(2,3-dimethylimidazol-3-ium-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 57463237) has the molecular formula C21H27F2N2O3+ and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 57463237 |
| Molecular Formula | C21H27F2N2O3+ |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | Cc1n(CCCOC(=O)[C@](O)(c2ccccc2)[C@H]2CCC(F)(F)C2)cc[n+]1C |
| InChI | InChI=1S/C21H27F2N2O3/c1-16-24(2)12-13-25(16)11-6-14-28-19(26)21(27,17-7-4-3-5-8-17)18-9-10-20(22,23)15-18/h3-5,7-8,12-13,18,27H,6,9-11,14-15H2,1-2H3/q+1/t18-,21-/m0/s1 |
| InChIKey | JNBCYOUNFJVFIT-RXVVDRJESA-N |
| XLogP | 2.88 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|