C17H23F2NO3 — CID 22594500
4-aminobutyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate (PubChem CID 22594500) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is 4-aminobutyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate.
| Compound Name | 4-aminobutyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 22594500 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-aminobutyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate |
| SMILES | NCCCCOC(=O)C(O)(c1ccccc1)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C17H23F2NO3/c18-16(19)9-8-14(12-16)17(22,13-6-2-1-3-7-13)15(21)23-11-5-4-10-20/h1-3,6-7,14,22H,4-5,8-12,20H2 |
| InChIKey | VYAJBFURWYCSEE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|