C21H28F2NO3+ — CID 25031749
(3,3-dimethyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl (2R)-2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate (PubChem CID 25031749) has the molecular formula C21H28F2NO3+ and a molecular weight of 380.46 g/mol. Its IUPAC name is (3,3-dimethyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl (2R)-2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate.
| Compound Name | (3,3-dimethyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl (2R)-2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 25031749 |
| Molecular Formula | C21H28F2NO3+ |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (3,3-dimethyl-3-azoniabicyclo[3.1.0]hexan-6-yl)methyl (2R)-2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(C)CC2C(COC(=O)[C@](O)(c3ccccc3)C3CCC(F)(F)C3)C2C1 |
| InChI | InChI=1S/C21H28F2NO3/c1-24(2)11-16-17(12-24)18(16)13-27-19(25)21(26,14-6-4-3-5-7-14)15-8-9-20(22,23)10-15/h3-7,15-18,26H,8-13H2,1-2H3/q+1/t15?,16?,17?,18?,21-/m0/s1 |
| InChIKey | RFFQZUMXHWZNLZ-AQMFNKKMSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|