C24H34F2N2O3 — CID 25003266
3-(3-butyl-2-methyl-2H-imidazol-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate (PubChem CID 25003266) has the molecular formula C24H34F2N2O3 and a molecular weight of 436.54 g/mol. Its IUPAC name is 3-(3-butyl-2-methyl-2H-imidazol-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate.
| Compound Name | 3-(3-butyl-2-methyl-2H-imidazol-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 25003266 |
| Molecular Formula | C24H34F2N2O3 |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 3-(3-butyl-2-methyl-2H-imidazol-1-yl)propyl (2R)-2-[(1S)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetate |
| SMILES | CCCCN1C=CN(CCCOC(=O)[C@](O)(c2ccccc2)[C@H]2CCC(F)(F)C2)C1C |
| InChI | InChI=1S/C24H34F2N2O3/c1-3-4-13-27-15-16-28(19(27)2)14-8-17-31-22(29)24(30,20-9-6-5-7-10-20)21-11-12-23(25,26)18-21/h5-7,9-10,15-16,19,21,30H,3-4,8,11-14,17-18H2,1-2H3/t19?,21-,24-/m0/s1 |
| InChIKey | SMUVZWMVFDUCIC-VFXOEBCRSA-N |
| XLogP | 4.48 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|