C26H37BrF2N2O3 — CID 57463345
3-(2-methyl-3-pentylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide (PubChem CID 57463345) has the molecular formula C26H37BrF2N2O3 and a molecular weight of 543.49 g/mol. Its IUPAC name is 3-(2-methyl-3-pentylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide.
| Compound Name | 3-(2-methyl-3-pentylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 57463345 |
| Molecular Formula | C26H37BrF2N2O3 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 3-(2-methyl-3-pentylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
| SMILES | CCCCCn1cc[n+](CCCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCCC(F)(F)C2)c1C.[Br-] |
| InChI | InChI=1S/C26H37F2N2O3.BrH/c1-3-4-8-15-29-17-18-30(21(29)2)16-10-19-33-24(31)26(32,22-11-6-5-7-12-22)23-13-9-14-25(27,28)20-23;/h5-7,11-12,17-18,23,32H,3-4,8-10,13-16,19-20H2,1-2H3;1H/q+1;/p-1/t23-,26+;/m1./s1 |
| InChIKey | JAYPLVLQSWADQS-VHNLPELQSA-M |
| XLogP | 1.92 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|