C25H35BrF2N2O3 — CID 57463343
3-(3-butyl-2-methylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide (PubChem CID 57463343) has the molecular formula C25H35BrF2N2O3 and a molecular weight of 529.47 g/mol. Its IUPAC name is 3-(3-butyl-2-methylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide.
| Compound Name | 3-(3-butyl-2-methylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 57463343 |
| Molecular Formula | C25H35BrF2N2O3 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 3-(3-butyl-2-methylimidazol-1-ium-1-yl)propyl (2R)-2-[(1R)-3,3-difluorocyclohexyl]-2-hydroxy-2-phenylacetate bromide |
| SMILES | CCCCn1cc[n+](CCCOC(=O)[C@](O)(c2ccccc2)[C@@H]2CCCC(F)(F)C2)c1C.[Br-] |
| InChI | InChI=1S/C25H35F2N2O3.BrH/c1-3-4-14-28-16-17-29(20(28)2)15-9-18-32-23(30)25(31,21-10-6-5-7-11-21)22-12-8-13-24(26,27)19-22;/h5-7,10-11,16-17,22,31H,3-4,8-9,12-15,18-19H2,1-2H3;1H/q+1;/p-1/t22-,25+;/m1./s1 |
| InChIKey | NCCPBIKAUHYMTR-RXTBOWBCSA-M |
| XLogP | 1.53 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|