C21H29ClF2N2O3 — CID 22594576
2-(1-methanimidoylpiperidin-3-yl)ethyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate;hydrochloride (PubChem CID 22594576) has the molecular formula C21H29ClF2N2O3 and a molecular weight of 430.92 g/mol. Its IUPAC name is 2-(1-methanimidoylpiperidin-3-yl)ethyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate;hydrochloride.
| Compound Name | 2-(1-methanimidoylpiperidin-3-yl)ethyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 22594576 |
| Molecular Formula | C21H29ClF2N2O3 |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-(1-methanimidoylpiperidin-3-yl)ethyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate;hydrochloride |
| SMILES | Cl.[H]/N=C/N1CCCC(CCOC(=O)C(O)(c2ccccc2)C2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C21H28F2N2O3.ClH/c22-20(23)10-8-18(13-20)21(27,17-6-2-1-3-7-17)19(26)28-12-9-16-5-4-11-25(14-16)15-24;/h1-3,6-7,15-16,18,24,27H,4-5,8-14H2;1H/b24-15+; |
| InChIKey | QWPHZZOQMQMVCI-CFYFISJPSA-N |
| XLogP | 3.98 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|