C21H27ClF2N2O3 — CID 90881930
2-(1-methanimidoylpiperidin-4-yl)ethyl (2R)-2-(4-chlorophenyl)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetate (PubChem CID 90881930) has the molecular formula C21H27ClF2N2O3 and a molecular weight of 428.91 g/mol. Its IUPAC name is 2-(1-methanimidoylpiperidin-4-yl)ethyl (2R)-2-(4-chlorophenyl)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetate.
| Compound Name | 2-(1-methanimidoylpiperidin-4-yl)ethyl (2R)-2-(4-chlorophenyl)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 90881930 |
| Molecular Formula | C21H27ClF2N2O3 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-(1-methanimidoylpiperidin-4-yl)ethyl (2R)-2-(4-chlorophenyl)-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxyacetate |
| SMILES | [H]/N=C/N1CCC(CCOC(=O)[C@](O)(c2ccc(Cl)cc2)[C@@H]2CCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C21H27ClF2N2O3/c22-18-3-1-16(2-4-18)21(28,17-5-9-20(23,24)13-17)19(27)29-12-8-15-6-10-26(14-25)11-7-15/h1-4,14-15,17,25,28H,5-13H2/b25-14+/t17-,21+/m1/s1 |
| InChIKey | QTPWSQUYISWNFH-JKWRJKHLSA-N |
| XLogP | 4.22 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|