C18H22F2N2O3 — CID 22594451
(1-methanimidoylpyrrolidin-3-yl) 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate (PubChem CID 22594451) has the molecular formula C18H22F2N2O3 and a molecular weight of 352.38 g/mol. Its IUPAC name is (1-methanimidoylpyrrolidin-3-yl) 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate.
| Compound Name | (1-methanimidoylpyrrolidin-3-yl) 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 22594451 |
| Molecular Formula | C18H22F2N2O3 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (1-methanimidoylpyrrolidin-3-yl) 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-phenylacetate |
| SMILES | [H]/N=C/N1CCC(OC(=O)C(O)(c2ccccc2)C2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C18H22F2N2O3/c19-17(20)8-6-14(10-17)18(24,13-4-2-1-3-5-13)16(23)25-15-7-9-22(11-15)12-21/h1-5,12,14-15,21,24H,6-11H2/b21-12+ |
| InChIKey | FUFIXSDHYJELIL-CIAFOILYSA-N |
| XLogP | 2.53 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|