C19H25F2N2O3S+ — CID 57434272
3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 57434272) has the molecular formula C19H25F2N2O3S+ and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 57434272 |
| Molecular Formula | C19H25F2N2O3S+ |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | Cc1n(CCCOC(=O)C(O)(c2cccs2)C2CCC(F)(F)C2)cc[n+]1C |
| InChI | InChI=1S/C19H25F2N2O3S/c1-14-22(2)9-10-23(14)8-4-11-26-17(24)19(25,16-5-3-12-27-16)15-6-7-18(20,21)13-15/h3,5,9-10,12,15,25H,4,6-8,11,13H2,1-2H3/q+1 |
| InChIKey | OPHNOIHKSCAXOJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|