C20H23N2O3S+ — CID 87437446
3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate (PubChem CID 87437446) has the molecular formula C20H23N2O3S+ and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate.
| Compound Name | 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 87437446 |
| Molecular Formula | C20H23N2O3S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-(2,3-dimethylimidazol-3-ium-1-yl)propyl 2-hydroxy-2-phenyl-2-thiophen-2-ylacetate |
| SMILES | Cc1n(CCCOC(=O)C(O)(c2ccccc2)c2cccs2)cc[n+]1C |
| InChI | InChI=1S/C20H23N2O3S/c1-16-21(2)12-13-22(16)11-7-14-25-19(23)20(24,18-10-6-15-26-18)17-8-4-3-5-9-17/h3-6,8-10,12-13,15,24H,7,11,14H2,1-2H3/q+1 |
| InChIKey | CPOVOXYLKYNLPE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|