C23H30N2O3 — CID 134094564
3-(4-methylpiperazin-1-yl)propyl 2-hydroxy-2-(2-methylphenyl)-2-phenylacetate (PubChem CID 134094564) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl 2-hydroxy-2-(2-methylphenyl)-2-phenylacetate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl 2-hydroxy-2-(2-methylphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 134094564 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl 2-hydroxy-2-(2-methylphenyl)-2-phenylacetate |
| SMILES | Cc1ccccc1C(O)(C(=O)OCCCN1CCN(C)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O3/c1-19-9-6-7-12-21(19)23(27,20-10-4-3-5-11-20)22(26)28-18-8-13-25-16-14-24(2)15-17-25/h3-7,9-12,27H,8,13-18H2,1-2H3 |
| InChIKey | IUJYAELZRPTZGA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|