C23H30N2O3 — CID 134109617
3-(4-methyl-1,4-diazepan-1-yl)propyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 134109617) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-(4-methyl-1,4-diazepan-1-yl)propyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | 3-(4-methyl-1,4-diazepan-1-yl)propyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 134109617 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-(4-methyl-1,4-diazepan-1-yl)propyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | CN1CCCN(CCCOC(=O)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O3/c1-24-14-8-15-25(18-17-24)16-9-19-28-22(26)23(27,20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-7,10-13,27H,8-9,14-19H2,1H3 |
| InChIKey | JYBKIWIHEGZXLQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|