C21H33NO3 — CID 68613442
2-(2-piperidin-1-ylethoxy)ethyl 2-ethyl-2-phenylbutanoate (PubChem CID 68613442) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethoxy)ethyl 2-ethyl-2-phenylbutanoate.
| Compound Name | 2-(2-piperidin-1-ylethoxy)ethyl 2-ethyl-2-phenylbutanoate |
|---|---|
| PubChem CID | 68613442 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 2-(2-piperidin-1-ylethoxy)ethyl 2-ethyl-2-phenylbutanoate |
| SMILES | CCC(CC)(C(=O)OCCOCCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H33NO3/c1-3-21(4-2,19-11-7-5-8-12-19)20(23)25-18-17-24-16-15-22-13-9-6-10-14-22/h5,7-8,11-12H,3-4,6,9-10,13-18H2,1-2H3 |
| InChIKey | AJTVPFNTJFALCR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|